C23H23NO4 — CID 70693661
(2S,3S)-N,3-dihydroxy-2-methyl-3-phenyl-2-[(4-phenylphenyl)methoxy]propanamide (PubChem CID 70693661) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is (2S,3S)-N,3-dihydroxy-2-methyl-3-phenyl-2-[(4-phenylphenyl)methoxy]propanamide.
| Compound Name | (2S,3S)-N,3-dihydroxy-2-methyl-3-phenyl-2-[(4-phenylphenyl)methoxy]propanamide |
|---|---|
| PubChem CID | 70693661 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (2S,3S)-N,3-dihydroxy-2-methyl-3-phenyl-2-[(4-phenylphenyl)methoxy]propanamide |
| SMILES | C[C@@](OCc1ccc(-c2ccccc2)cc1)(C(=O)NO)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C23H23NO4/c1-23(22(26)24-27,21(25)20-10-6-3-7-11-20)28-16-17-12-14-19(15-13-17)18-8-4-2-5-9-18/h2-15,21,25,27H,16H2,1H3,(H,24,26)/t21-,23-/m0/s1 |
| InChIKey | WFVASGYQNPHMCF-GMAHTHKFSA-N |
| XLogP | 3.87 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|