C19H23NO4 — CID 70693659
(2R,3S)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]pentanamide (PubChem CID 70693659) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is (2R,3S)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]pentanamide.
| Compound Name | (2R,3S)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]pentanamide |
|---|---|
| PubChem CID | 70693659 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (2R,3S)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]pentanamide |
| SMILES | CC[C@H](O)[C@@](C)(OCc1ccc(-c2ccccc2)cc1)C(=O)NO |
| InChI | InChI=1S/C19H23NO4/c1-3-17(21)19(2,18(22)20-23)24-13-14-9-11-16(12-10-14)15-7-5-4-6-8-15/h4-12,17,21,23H,3,13H2,1-2H3,(H,20,22)/t17-,19+/m0/s1 |
| InChIKey | VKJROWRLVCWQPU-PKOBYXMFSA-N |
| XLogP | 2.91 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|