C21H27NO5 — CID 70689468
(2S,3S)-5-ethoxy-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]pentanamide (PubChem CID 70689468) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is (2S,3S)-5-ethoxy-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]pentanamide.
| Compound Name | (2S,3S)-5-ethoxy-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]pentanamide |
|---|---|
| PubChem CID | 70689468 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (2S,3S)-5-ethoxy-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]pentanamide |
| SMILES | CCOCC[C@H](O)[C@](C)(OCc1ccc(-c2ccccc2)cc1)C(=O)NO |
| InChI | InChI=1S/C21H27NO5/c1-3-26-14-13-19(23)21(2,20(24)22-25)27-15-16-9-11-18(12-10-16)17-7-5-4-6-8-17/h4-12,19,23,25H,3,13-15H2,1-2H3,(H,22,24)/t19-,21-/m0/s1 |
| InChIKey | KXQHQOVKEMSLRA-FPOVZHCZSA-N |
| XLogP | 2.92 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|