C31H39NO5 — CID 15139780
(2S,3R,4R,6S)-3-hydroxy-N,2-dimethoxy-N,4,6-trimethyl-7-trityloxyheptanamide (PubChem CID 15139780) has the molecular formula C31H39NO5 and a molecular weight of 505.66 g/mol. Its IUPAC name is (2S,3R,4R,6S)-3-hydroxy-N,2-dimethoxy-N,4,6-trimethyl-7-trityloxyheptanamide.
| Compound Name | (2S,3R,4R,6S)-3-hydroxy-N,2-dimethoxy-N,4,6-trimethyl-7-trityloxyheptanamide |
|---|---|
| PubChem CID | 15139780 |
| Molecular Formula | C31H39NO5 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | (2S,3R,4R,6S)-3-hydroxy-N,2-dimethoxy-N,4,6-trimethyl-7-trityloxyheptanamide |
| SMILES | CO[C@H](C(=O)N(C)OC)[C@H](O)[C@H](C)C[C@H](C)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H39NO5/c1-23(21-24(2)28(33)29(35-4)30(34)32(3)36-5)22-37-31(25-15-9-6-10-16-25,26-17-11-7-12-18-26)27-19-13-8-14-20-27/h6-20,23-24,28-29,33H,21-22H2,1-5H3/t23-,24+,28+,29-/m0/s1 |
| InChIKey | IFHHZMVCZLFHRX-OTEJSBPHSA-N |
| XLogP | 5.05 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|