C35H39N3O9 — CID 134838057
ditert-butyl (2S)-2-[[4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-nitrobenzoyl]amino]pentanedioate (PubChem CID 134838057) has the molecular formula C35H39N3O9 and a molecular weight of 645.71 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-nitrobenzoyl]amino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-nitrobenzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 134838057 |
| Molecular Formula | C35H39N3O9 |
| Molecular Weight | 645.71 g/mol |
| Exact Mass | 645.27 |
| IUPAC Name | ditert-butyl (2S)-2-[[4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-nitrobenzoyl]amino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)c1ccc(NC(=O)OCC2c3ccccc3-c3ccccc32)cc1[N+](=O)[O-])C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H39N3O9/c1-34(2,3)46-30(39)18-17-28(32(41)47-35(4,5)6)37-31(40)26-16-15-21(19-29(26)38(43)44)36-33(42)45-20-27-24-13-9-7-11-22(24)23-12-8-10-14-25(23)27/h7-16,19,27-28H,17-18,20H2,1-6H3,(H,36,42)(H,37,40)/t28-/m0/s1 |
| InChIKey | MEFCJHBOAXYVLF-NDEPHWFRSA-N |
| XLogP | 6.52 |
| TPSA | 163.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.71 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|