C19H30O3 — CID 134838386
(4aR,4bS,8R,8aS)-8-(methoxymethoxymethyl)-4b,8-dimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one (PubChem CID 134838386) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (4aR,4bS,8R,8aS)-8-(methoxymethoxymethyl)-4b,8-dimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one.
| Compound Name | (4aR,4bS,8R,8aS)-8-(methoxymethoxymethyl)-4b,8-dimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 134838386 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (4aR,4bS,8R,8aS)-8-(methoxymethoxymethyl)-4b,8-dimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one |
| SMILES | COCOC[C@]1(C)CCC[C@@]2(C)[C@@H]3CCC(=O)C=C3CC[C@H]12 |
| InChI | InChI=1S/C19H30O3/c1-18(12-22-13-21-3)9-4-10-19(2)16-7-6-15(20)11-14(16)5-8-17(18)19/h11,16-17H,4-10,12-13H2,1-3H3/t16-,17-,18+,19+/m1/s1 |
| InChIKey | MVSZEAPKCFGUNN-YRXWBPOGSA-N |
| XLogP | 4.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|