C36H35F6N4O2+ — CID 134838910
1-[(R)-(1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-3-[3,5-bis(trifluoromethyl)phenyl]urea (PubChem CID 134838910) has the molecular formula C36H35F6N4O2+ and a molecular weight of 669.69 g/mol. Its IUPAC name is 1-[(R)-(1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-3-[3,5-bis(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(R)-(1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-3-[3,5-bis(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 134838910 |
| Molecular Formula | C36H35F6N4O2+ |
| Molecular Weight | 669.69 g/mol |
| Exact Mass | 669.27 |
| IUPAC Name | 1-[(R)-(1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-3-[3,5-bis(trifluoromethyl)phenyl]urea |
| SMILES | C=CC1C[N+]2(Cc3ccccc3)CCC1CC2[C@H](NC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C36H34F6N4O2/c1-3-23-21-46(20-22-7-5-4-6-8-22)14-12-24(23)15-32(46)33(29-11-13-43-31-10-9-28(48-2)19-30(29)31)45-34(47)44-27-17-25(35(37,38)39)16-26(18-27)36(40,41)42/h3-11,13,16-19,23-24,32-33H,1,12,14-15,20-21H2,2H3,(H-,44,45,47)/p+1/t23?,24?,32?,33-,46?/m1/s1 |
| InChIKey | RXHARXQHRQGGQE-OZOBUSMNSA-O |
| XLogP | 8.76 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.69 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|