C42H52FN4O2+ — CID 162397246
1-[(S)-[(1S,2R,4S,5R)-1-[(3,5-ditert-butylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(7-methoxyquinolin-4-yl)methyl]-3-(4-fluorophenyl)urea (PubChem CID 162397246) has the molecular formula C42H52FN4O2+ and a molecular weight of 663.90 g/mol. Its IUPAC name is 1-[(S)-[(1S,2R,4S,5R)-1-[(3,5-ditert-butylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(7-methoxyquinolin-4-yl)methyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[(S)-[(1S,2R,4S,5R)-1-[(3,5-ditert-butylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(7-methoxyquinolin-4-yl)methyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 162397246 |
| Molecular Formula | C42H52FN4O2+ |
| Molecular Weight | 663.90 g/mol |
| Exact Mass | 663.41 |
| IUPAC Name | 1-[(S)-[(1S,2R,4S,5R)-1-[(3,5-ditert-butylphenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(7-methoxyquinolin-4-yl)methyl]-3-(4-fluorophenyl)urea |
| SMILES | C=C[C@H]1C[N@+]2(Cc3cc(C(C)(C)C)cc(C(C)(C)C)c3)CC[C@H]1C[C@@H]2[C@@H](NC(=O)Nc1ccc(F)cc1)c1ccnc2cc(OC)ccc12 |
| InChI | InChI=1S/C42H51FN4O2/c1-9-28-26-47(25-27-20-30(41(2,3)4)23-31(21-27)42(5,6)7)19-17-29(28)22-38(47)39(46-40(48)45-33-12-10-32(43)11-13-33)36-16-18-44-37-24-34(49-8)14-15-35(36)37/h9-16,18,20-21,23-24,28-29,38-39H,1,17,19,22,25-26H2,2-8H3,(H-,45,46,48)/p+1/t28-,29-,38+,39-,47+/m0/s1 |
| InChIKey | VNGXMUXPSJPNOF-AXPYNGBASA-O |
| XLogP | 9.45 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.90 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|