C20H44O3Si2 — CID 134841575
(E,2R,3S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5-dimethylhex-4-en-1-ol (PubChem CID 134841575) has the molecular formula C20H44O3Si2 and a molecular weight of 388.74 g/mol. Its IUPAC name is (E,2R,3S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5-dimethylhex-4-en-1-ol.
| Compound Name | (E,2R,3S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5-dimethylhex-4-en-1-ol |
|---|---|
| PubChem CID | 134841575 |
| Molecular Formula | C20H44O3Si2 |
| Molecular Weight | 388.74 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | (E,2R,3S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2,5-dimethylhex-4-en-1-ol |
| SMILES | C/C(=C\[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CO)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H44O3Si2/c1-16(15-22-24(9,10)19(3,4)5)13-18(17(2)14-21)23-25(11,12)20(6,7)8/h13,17-18,21H,14-15H2,1-12H3/b16-13+/t17-,18+/m1/s1 |
| InChIKey | KNYYNWHCQHQFBF-WWMCSRHNSA-N |
| XLogP | 5.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.74 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|