C18H21N3 — CID 134843097
(14aR)-8,14-dimethyl-5,6,9,14a-tetrahydroisoquinolino[1,2-b][1,3,4]benzotriazepine (PubChem CID 134843097) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is (14aR)-8,14-dimethyl-5,6,9,14a-tetrahydroisoquinolino[1,2-b][1,3,4]benzotriazepine.
| Compound Name | (14aR)-8,14-dimethyl-5,6,9,14a-tetrahydroisoquinolino[1,2-b][1,3,4]benzotriazepine |
|---|---|
| PubChem CID | 134843097 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | (14aR)-8,14-dimethyl-5,6,9,14a-tetrahydroisoquinolino[1,2-b][1,3,4]benzotriazepine |
| SMILES | CN1c2ccccc2CN(C)N2CCc3ccccc3[C@H]12 |
| InChI | InChI=1S/C18H21N3/c1-19-13-15-8-4-6-10-17(15)20(2)18-16-9-5-3-7-14(16)11-12-21(18)19/h3-10,18H,11-13H2,1-2H3/t18-/m1/s1 |
| InChIKey | PIQPROJHKNFZIT-GOSISDBHSA-N |
| XLogP | 3.04 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|