C38H45NO7 — CID 134843173
(4S)-4-[(3S)-2-benzyl-4,4-dimethoxyoxazinan-3-yl]-2,3,4-tris(phenylmethoxy)butan-1-ol (PubChem CID 134843173) has the molecular formula C38H45NO7 and a molecular weight of 627.78 g/mol. Its IUPAC name is (4S)-4-[(3S)-2-benzyl-4,4-dimethoxyoxazinan-3-yl]-2,3,4-tris(phenylmethoxy)butan-1-ol.
| Compound Name | (4S)-4-[(3S)-2-benzyl-4,4-dimethoxyoxazinan-3-yl]-2,3,4-tris(phenylmethoxy)butan-1-ol |
|---|---|
| PubChem CID | 134843173 |
| Molecular Formula | C38H45NO7 |
| Molecular Weight | 627.78 g/mol |
| Exact Mass | 627.32 |
| IUPAC Name | (4S)-4-[(3S)-2-benzyl-4,4-dimethoxyoxazinan-3-yl]-2,3,4-tris(phenylmethoxy)butan-1-ol |
| SMILES | COC1(OC)CCON(Cc2ccccc2)[C@H]1[C@H](OCc1ccccc1)C(OCc1ccccc1)C(CO)OCc1ccccc1 |
| InChI | InChI=1S/C38H45NO7/c1-41-38(42-2)23-24-46-39(25-30-15-7-3-8-16-30)37(38)36(45-29-33-21-13-6-14-22-33)35(44-28-32-19-11-5-12-20-32)34(26-40)43-27-31-17-9-4-10-18-31/h3-22,34-37,40H,23-29H2,1-2H3/t34?,35?,36-,37+/m1/s1 |
| InChIKey | ZGKPDLSRJGTZKZ-NBASHWNPSA-N |
| XLogP | 5.93 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.78 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|