C19H18 — CID 134848598
spiro[cycloheptene-3,9'-fluorene] (PubChem CID 134848598) has the molecular formula C19H18 and a molecular weight of 246.35 g/mol. Its IUPAC name is spiro[cycloheptene-3,9'-fluorene].
| Compound Name | spiro[cycloheptene-3,9'-fluorene] |
|---|---|
| PubChem CID | 134848598 |
| Molecular Formula | C19H18 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | spiro[cycloheptene-3,9'-fluorene] |
| SMILES | C1=CC2(CCCC1)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C19H18/c1-2-8-14-19(13-7-1)17-11-5-3-9-15(17)16-10-4-6-12-18(16)19/h3-7,9-13H,1-2,8,14H2 |
| InChIKey | LOJJPZCTQLPWOY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|