C14H15NO — CID 10059075
(3S)-1'-methylspiro[cyclohexene-3,3'-indole]-2'-one (PubChem CID 10059075) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is (3S)-1'-methylspiro[cyclohexene-3,3'-indole]-2'-one.
| Compound Name | (3S)-1'-methylspiro[cyclohexene-3,3'-indole]-2'-one |
|---|---|
| PubChem CID | 10059075 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | (3S)-1'-methylspiro[cyclohexene-3,3'-indole]-2'-one |
| SMILES | CN1C(=O)[C@@]2(C=CCCC2)c2ccccc21 |
| InChI | InChI=1S/C14H15NO/c1-15-12-8-4-3-7-11(12)14(13(15)16)9-5-2-6-10-14/h3-5,7-9H,2,6,10H2,1H3/t14-/m1/s1 |
| InChIKey | SYRSTROSBZHZIC-CQSZACIVSA-N |
| XLogP | 2.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|