C22H23Br — CID 134852441
1-bromo-4-[(2Z)-5-methylidene-9-phenylnona-2,8-dienyl]benzene (PubChem CID 134852441) has the molecular formula C22H23Br and a molecular weight of 367.33 g/mol. Its IUPAC name is 1-bromo-4-[(2Z)-5-methylidene-9-phenylnona-2,8-dienyl]benzene.
| Compound Name | 1-bromo-4-[(2Z)-5-methylidene-9-phenylnona-2,8-dienyl]benzene |
|---|---|
| PubChem CID | 134852441 |
| Molecular Formula | C22H23Br |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 1-bromo-4-[(2Z)-5-methylidene-9-phenylnona-2,8-dienyl]benzene |
| SMILES | C=C(C/C=C\Cc1ccc(Br)cc1)CCC=Cc1ccccc1 |
| InChI | InChI=1S/C22H23Br/c1-19(9-5-7-13-20-11-3-2-4-12-20)10-6-8-14-21-15-17-22(23)18-16-21/h2-4,6-8,11-13,15-18H,1,5,9-10,14H2/b8-6-,13-7? |
| InChIKey | BEVRNNLWXNHJEY-QBXRYFARSA-N |
| XLogP | 6.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|