C25H28 — CID 58674078
[(1E)-9-methyl-4,7-dimethylidene-8-phenyldeca-1,9-dienyl]benzene (PubChem CID 58674078) has the molecular formula C25H28 and a molecular weight of 328.50 g/mol. Its IUPAC name is [(1E)-9-methyl-4,7-dimethylidene-8-phenyldeca-1,9-dienyl]benzene.
| Compound Name | [(1E)-9-methyl-4,7-dimethylidene-8-phenyldeca-1,9-dienyl]benzene |
|---|---|
| PubChem CID | 58674078 |
| Molecular Formula | C25H28 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | [(1E)-9-methyl-4,7-dimethylidene-8-phenyldeca-1,9-dienyl]benzene |
| SMILES | C=C(C/C=C/c1ccccc1)CCC(=C)C(C(=C)C)c1ccccc1 |
| InChI | InChI=1S/C25H28/c1-20(2)25(24-16-9-6-10-17-24)22(4)19-18-21(3)12-11-15-23-13-7-5-8-14-23/h5-11,13-17,25H,1,3-4,12,18-19H2,2H3/b15-11+ |
| InChIKey | NROWZUPAFBYGSN-RVDMUPIBSA-N |
| XLogP | 7.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|