C11H21NO2S2 — CID 134856350
2-[bis(ethylsulfanyl)methylidene]-3-hydroxy-N,N-dimethylbutanamide (PubChem CID 134856350) has the molecular formula C11H21NO2S2 and a molecular weight of 263.43 g/mol. Its IUPAC name is 2-[bis(ethylsulfanyl)methylidene]-3-hydroxy-N,N-dimethylbutanamide.
| Compound Name | 2-[bis(ethylsulfanyl)methylidene]-3-hydroxy-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 134856350 |
| Molecular Formula | C11H21NO2S2 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-[bis(ethylsulfanyl)methylidene]-3-hydroxy-N,N-dimethylbutanamide |
| SMILES | CCSC(SCC)=C(C(=O)N(C)C)C(C)O |
| InChI | InChI=1S/C11H21NO2S2/c1-6-15-11(16-7-2)9(8(3)13)10(14)12(4)5/h8,13H,6-7H2,1-5H3 |
| InChIKey | AHBFAMZSWQUAPE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|