C13H15NOSe — CID 134858960
(8S)-2-phenylselanyl-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 134858960) has the molecular formula C13H15NOSe and a molecular weight of 280.23 g/mol. Its IUPAC name is (8S)-2-phenylselanyl-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (8S)-2-phenylselanyl-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 134858960 |
| Molecular Formula | C13H15NOSe |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | (8S)-2-phenylselanyl-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | O=C1C([Se]c2ccccc2)C[C@@H]2CCCN12 |
| InChI | InChI=1S/C13H15NOSe/c15-13-12(9-10-5-4-8-14(10)13)16-11-6-2-1-3-7-11/h1-3,6-7,10,12H,4-5,8-9H2/t10-,12?/m0/s1 |
| InChIKey | FGSJKJXUHGSKOB-NUHJPDEHSA-N |
| XLogP | 1.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|