C42H47NO8 — CID 134865066
methyl (3S,4R,6R,7S,10S)-10-acetyloxy-8-benzyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-oxa-8-azaspiro[5.5]undecane-7-carboxylate (PubChem CID 134865066) has the molecular formula C42H47NO8 and a molecular weight of 693.84 g/mol. Its IUPAC name is methyl (3S,4R,6R,7S,10S)-10-acetyloxy-8-benzyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-oxa-8-azaspiro[5.5]undecane-7-carboxylate.
| Compound Name | methyl (3S,4R,6R,7S,10S)-10-acetyloxy-8-benzyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-oxa-8-azaspiro[5.5]undecane-7-carboxylate |
|---|---|
| PubChem CID | 134865066 |
| Molecular Formula | C42H47NO8 |
| Molecular Weight | 693.84 g/mol |
| Exact Mass | 693.33 |
| IUPAC Name | methyl (3S,4R,6R,7S,10S)-10-acetyloxy-8-benzyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-oxa-8-azaspiro[5.5]undecane-7-carboxylate |
| SMILES | COC(=O)[C@H]1N(Cc2ccccc2)C[C@@H](OC(C)=O)C[C@@]12C[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)C(COCc1ccccc1)O2 |
| InChI | InChI=1S/C42H47NO8/c1-31(44)50-36-23-42(40(41(45)46-2)43(26-36)25-32-15-7-3-8-16-32)24-37(48-28-34-19-11-5-12-20-34)39(49-29-35-21-13-6-14-22-35)38(51-42)30-47-27-33-17-9-4-10-18-33/h3-22,36-40H,23-30H2,1-2H3/t36-,37+,38?,39-,40+,42+/m0/s1 |
| InChIKey | UATCQCKQGJYKDT-SZVFFSHVSA-N |
| XLogP | 6.28 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.84 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |