C42H47NO10S — CID 134958009
diethyl (2R,3R,4R,4aS,5S,7aR)-6-methylsulfonyl-5-phenyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,7a-hexahydropyrano[2,3-c]pyrrole-7,7-dicarboxylate (PubChem CID 134958009) has the molecular formula C42H47NO10S and a molecular weight of 757.90 g/mol. Its IUPAC name is diethyl (2R,3R,4R,4aS,5S,7aR)-6-methylsulfonyl-5-phenyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,7a-hexahydropyrano[2,3-c]pyrrole-7,7-dicarboxylate.
| Compound Name | diethyl (2R,3R,4R,4aS,5S,7aR)-6-methylsulfonyl-5-phenyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,7a-hexahydropyrano[2,3-c]pyrrole-7,7-dicarboxylate |
|---|---|
| PubChem CID | 134958009 |
| Molecular Formula | C42H47NO10S |
| Molecular Weight | 757.90 g/mol |
| Exact Mass | 757.29 |
| IUPAC Name | diethyl (2R,3R,4R,4aS,5S,7aR)-6-methylsulfonyl-5-phenyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,7a-hexahydropyrano[2,3-c]pyrrole-7,7-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@@H]2O[C@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2[C@@H](c2ccccc2)N1S(C)(=O)=O |
| InChI | InChI=1S/C42H47NO10S/c1-4-49-40(44)42(41(45)50-5-2)39-35(36(43(42)54(3,46)47)33-24-16-9-17-25-33)38(52-28-32-22-14-8-15-23-32)37(51-27-31-20-12-7-13-21-31)34(53-39)29-48-26-30-18-10-6-11-19-30/h6-25,34-39H,4-5,26-29H2,1-3H3/t34-,35-,36-,37+,38-,39-/m1/s1 |
| InChIKey | RAYJNAURRZHMNT-LBRCBTLPSA-N |
| XLogP | 5.64 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.90 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|