C24H27NO7S — CID 134958017
diethyl (1R,3aS,9bR)-2-methylsulfonyl-1-phenyl-1,3a,5,9b-tetrahydroisochromeno[3,4-c]pyrrole-3,3-dicarboxylate (PubChem CID 134958017) has the molecular formula C24H27NO7S and a molecular weight of 473.55 g/mol. Its IUPAC name is diethyl (1R,3aS,9bR)-2-methylsulfonyl-1-phenyl-1,3a,5,9b-tetrahydroisochromeno[3,4-c]pyrrole-3,3-dicarboxylate.
| Compound Name | diethyl (1R,3aS,9bR)-2-methylsulfonyl-1-phenyl-1,3a,5,9b-tetrahydroisochromeno[3,4-c]pyrrole-3,3-dicarboxylate |
|---|---|
| PubChem CID | 134958017 |
| Molecular Formula | C24H27NO7S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | diethyl (1R,3aS,9bR)-2-methylsulfonyl-1-phenyl-1,3a,5,9b-tetrahydroisochromeno[3,4-c]pyrrole-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H]2OCc3ccccc3[C@@H]2[C@H](c2ccccc2)N1S(C)(=O)=O |
| InChI | InChI=1S/C24H27NO7S/c1-4-30-22(26)24(23(27)31-5-2)21-19(18-14-10-9-13-17(18)15-32-21)20(25(24)33(3,28)29)16-11-7-6-8-12-16/h6-14,19-21H,4-5,15H2,1-3H3/t19-,20+,21+/m1/s1 |
| InChIKey | GAWNHNJFTXBXSZ-HKBOAZHASA-N |
| XLogP | 2.55 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|