C27H33NO8S — CID 134958014
diethyl (4aR,5R,7aS)-6-methylsulfonyl-5-phenyl-7a-phenylmethoxy-3,4,4a,5-tetrahydro-2H-pyrano[2,3-c]pyrrole-7,7-dicarboxylate (PubChem CID 134958014) has the molecular formula C27H33NO8S and a molecular weight of 531.63 g/mol. Its IUPAC name is diethyl (4aR,5R,7aS)-6-methylsulfonyl-5-phenyl-7a-phenylmethoxy-3,4,4a,5-tetrahydro-2H-pyrano[2,3-c]pyrrole-7,7-dicarboxylate.
| Compound Name | diethyl (4aR,5R,7aS)-6-methylsulfonyl-5-phenyl-7a-phenylmethoxy-3,4,4a,5-tetrahydro-2H-pyrano[2,3-c]pyrrole-7,7-dicarboxylate |
|---|---|
| PubChem CID | 134958014 |
| Molecular Formula | C27H33NO8S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | diethyl (4aR,5R,7aS)-6-methylsulfonyl-5-phenyl-7a-phenylmethoxy-3,4,4a,5-tetrahydro-2H-pyrano[2,3-c]pyrrole-7,7-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)N(S(C)(=O)=O)[C@@H](c2ccccc2)[C@H]2CCCO[C@]21OCc1ccccc1 |
| InChI | InChI=1S/C27H33NO8S/c1-4-33-24(29)26(25(30)34-5-2)27(36-19-20-13-8-6-9-14-20)22(17-12-18-35-27)23(28(26)37(3,31)32)21-15-10-7-11-16-21/h6-11,13-16,22-23H,4-5,12,17-19H2,1-3H3/t22-,23+,27+/m1/s1 |
| InChIKey | BDSUOTMOHDRKHF-KHVXQDHOSA-N |
| XLogP | 3.21 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|