C38H41NO6 — CID 135018694
ethyl (6S,7R,7aR)-2-phenyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrole-3-carboxylate (PubChem CID 135018694) has the molecular formula C38H41NO6 and a molecular weight of 607.75 g/mol. Its IUPAC name is ethyl (6S,7R,7aR)-2-phenyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrole-3-carboxylate.
| Compound Name | ethyl (6S,7R,7aR)-2-phenyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 135018694 |
| Molecular Formula | C38H41NO6 |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.29 |
| IUPAC Name | ethyl (6S,7R,7aR)-2-phenyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1C(c2ccccc2)N[C@@H]2C1OC(COCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C38H41NO6/c1-2-42-38(40)32-33(30-21-13-6-14-22-30)39-34-36(32)45-31(26-41-23-27-15-7-3-8-16-27)35(43-24-28-17-9-4-10-18-28)37(34)44-25-29-19-11-5-12-20-29/h3-22,31-37,39H,2,23-26H2,1H3/t31?,32?,33?,34-,35-,36?,37-/m1/s1 |
| InChIKey | GEYZQVLGVYNGCC-FEWYANIJSA-N |
| XLogP | 6.03 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |