C49H53NO9 — CID 59531316
methyl (3S,4S,6S,7S,10S)-10-acetyloxy-8-benzyl-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1-oxa-8-azaspiro[5.5]undecane-7-carboxylate (PubChem CID 59531316) has the molecular formula C49H53NO9 and a molecular weight of 799.96 g/mol. Its IUPAC name is methyl (3S,4S,6S,7S,10S)-10-acetyloxy-8-benzyl-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1-oxa-8-azaspiro[5.5]undecane-7-carboxylate.
| Compound Name | methyl (3S,4S,6S,7S,10S)-10-acetyloxy-8-benzyl-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1-oxa-8-azaspiro[5.5]undecane-7-carboxylate |
|---|---|
| PubChem CID | 59531316 |
| Molecular Formula | C49H53NO9 |
| Molecular Weight | 799.96 g/mol |
| Exact Mass | 799.37 |
| IUPAC Name | methyl (3S,4S,6S,7S,10S)-10-acetyloxy-8-benzyl-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1-oxa-8-azaspiro[5.5]undecane-7-carboxylate |
| SMILES | COC(=O)[C@H]1N(Cc2ccccc2)C[C@@H](OC(C)=O)C[C@]12OC(COCc1ccccc1)[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)C2OCc1ccccc1 |
| InChI | InChI=1S/C49H53NO9/c1-36(51)58-42-28-49(46(48(52)53-2)50(30-42)29-37-18-8-3-9-19-37)47(57-34-41-26-16-7-17-27-41)45(56-33-40-24-14-6-15-25-40)44(55-32-39-22-12-5-13-23-39)43(59-49)35-54-31-38-20-10-4-11-21-38/h3-27,42-47H,28-35H2,1-2H3/t42-,43?,44-,45-,46+,47?,49-/m0/s1 |
| InChIKey | QKZPJSGFJNHSSU-ZMILGCSLSA-N |
| XLogP | 7.48 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.96 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |