C47H50INO7 — CID 134864838
methyl (3R,6S,7S)-8-benzyl-10-iodo-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1-oxa-8-azaspiro[5.5]undecane-7-carboxylate (PubChem CID 134864838) has the molecular formula C47H50INO7 and a molecular weight of 867.82 g/mol. Its IUPAC name is methyl (3R,6S,7S)-8-benzyl-10-iodo-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1-oxa-8-azaspiro[5.5]undecane-7-carboxylate.
| Compound Name | methyl (3R,6S,7S)-8-benzyl-10-iodo-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1-oxa-8-azaspiro[5.5]undecane-7-carboxylate |
|---|---|
| PubChem CID | 134864838 |
| Molecular Formula | C47H50INO7 |
| Molecular Weight | 867.82 g/mol |
| Exact Mass | 867.26 |
| IUPAC Name | methyl (3R,6S,7S)-8-benzyl-10-iodo-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-1-oxa-8-azaspiro[5.5]undecane-7-carboxylate |
| SMILES | COC(=O)[C@H]1N(Cc2ccccc2)CC(I)C[C@]12OC(COCc1ccccc1)[C@@H](OCc1ccccc1)C(OCc1ccccc1)C2OCc1ccccc1 |
| InChI | InChI=1S/C47H50INO7/c1-51-46(50)44-47(27-40(48)29-49(44)28-35-17-7-2-8-18-35)45(55-33-39-25-15-6-16-26-39)43(54-32-38-23-13-5-14-24-38)42(53-31-37-21-11-4-12-22-37)41(56-47)34-52-30-36-19-9-3-10-20-36/h2-26,40-45H,27-34H2,1H3/t40?,41?,42-,43?,44-,45?,47+/m1/s1 |
| InChIKey | SQSSTYXTGSLIDF-LNHJGWBPSA-N |
| XLogP | 8.35 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.82 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|