C42H43NO5 — CID 57020099
(2S,3S,4S,6R)-1-benzyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine-2-carbaldehyde (PubChem CID 57020099) has the molecular formula C42H43NO5 and a molecular weight of 641.81 g/mol. Its IUPAC name is (2S,3S,4S,6R)-1-benzyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine-2-carbaldehyde.
| Compound Name | (2S,3S,4S,6R)-1-benzyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 57020099 |
| Molecular Formula | C42H43NO5 |
| Molecular Weight | 641.81 g/mol |
| Exact Mass | 641.31 |
| IUPAC Name | (2S,3S,4S,6R)-1-benzyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine-2-carbaldehyde |
| SMILES | O=C[C@@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)[C@@H](COCc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C42H43NO5/c44-27-38-40(46-29-35-20-10-3-11-21-35)42(48-31-37-24-14-5-15-25-37)41(47-30-36-22-12-4-13-23-36)39(32-45-28-34-18-8-2-9-19-34)43(38)26-33-16-6-1-7-17-33/h1-25,27,38-42H,26,28-32H2/t38-,39-,40+,41?,42-/m1/s1 |
| InChIKey | ZNBOUNFLBQLWPX-RFWIWLRGSA-N |
| XLogP | 7.41 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.81 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|