C20H26O6S — CID 134865082
(6-ethylsulfanyl-7-oxo-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl) 2,2-dimethylpropanoate (PubChem CID 134865082) has the molecular formula C20H26O6S and a molecular weight of 394.49 g/mol. Its IUPAC name is (6-ethylsulfanyl-7-oxo-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl) 2,2-dimethylpropanoate.
| Compound Name | (6-ethylsulfanyl-7-oxo-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134865082 |
| Molecular Formula | C20H26O6S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (6-ethylsulfanyl-7-oxo-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl) 2,2-dimethylpropanoate |
| SMILES | CCSC1OC2COC(c3ccccc3)OC2C(OC(=O)C(C)(C)C)C1=O |
| InChI | InChI=1S/C20H26O6S/c1-5-27-18-14(21)16(26-19(22)20(2,3)4)15-13(24-18)11-23-17(25-15)12-9-7-6-8-10-12/h6-10,13,15-18H,5,11H2,1-4H3 |
| InChIKey | SMDVTAYPSXFSQY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |