C22H27NO8 — CID 134865523
triethyl (4S,6S,7S,8R,8aS)-1-oxo-4-phenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine-6,7,8-tricarboxylate (PubChem CID 134865523) has the molecular formula C22H27NO8 and a molecular weight of 433.46 g/mol. Its IUPAC name is triethyl (4S,6S,7S,8R,8aS)-1-oxo-4-phenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine-6,7,8-tricarboxylate.
| Compound Name | triethyl (4S,6S,7S,8R,8aS)-1-oxo-4-phenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine-6,7,8-tricarboxylate |
|---|---|
| PubChem CID | 134865523 |
| Molecular Formula | C22H27NO8 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | triethyl (4S,6S,7S,8R,8aS)-1-oxo-4-phenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine-6,7,8-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](C(=O)OCC)[C@@H](C(=O)OCC)N2[C@@H](c3ccccc3)COC(=O)[C@H]12 |
| InChI | InChI=1S/C22H27NO8/c1-4-28-19(24)15-16(20(25)29-5-2)18-22(27)31-12-14(13-10-8-7-9-11-13)23(18)17(15)21(26)30-6-3/h7-11,14-18H,4-6,12H2,1-3H3/t14-,15+,16-,17+,18+/m1/s1 |
| InChIKey | RPIZNRAERDMCTC-WKULXVSPSA-N |
| XLogP | 1.26 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|