C8H16N6O2 — CID 134868467
2-[[4,5-diamino-6-(2-hydroxyethylamino)pyridazin-3-yl]amino]ethanol (PubChem CID 134868467) has the molecular formula C8H16N6O2 and a molecular weight of 228.26 g/mol. Its IUPAC name is 2-[[4,5-diamino-6-(2-hydroxyethylamino)pyridazin-3-yl]amino]ethanol.
| Compound Name | 2-[[4,5-diamino-6-(2-hydroxyethylamino)pyridazin-3-yl]amino]ethanol |
|---|---|
| PubChem CID | 134868467 |
| Molecular Formula | C8H16N6O2 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2-[[4,5-diamino-6-(2-hydroxyethylamino)pyridazin-3-yl]amino]ethanol |
| SMILES | Nc1c(NCCO)nnc(NCCO)c1N |
| InChI | InChI=1S/C8H16N6O2/c9-5-6(10)8(12-2-4-16)14-13-7(5)11-1-3-15/h15-16H,1-4H2,(H3,10,11,13)(H3,9,12,14) |
| InChIKey | PMPAVISDCHKBAG-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 142.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|