C20H31NO2 — CID 134870971
(E,2R)-N-benzyl-2-(2-methoxypropan-2-yloxy)non-3-en-1-imine (PubChem CID 134870971) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is (E,2R)-N-benzyl-2-(2-methoxypropan-2-yloxy)non-3-en-1-imine.
| Compound Name | (E,2R)-N-benzyl-2-(2-methoxypropan-2-yloxy)non-3-en-1-imine |
|---|---|
| PubChem CID | 134870971 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | (E,2R)-N-benzyl-2-(2-methoxypropan-2-yloxy)non-3-en-1-imine |
| SMILES | CCCCC/C=C/[C@H](/C=N/Cc1ccccc1)OC(C)(C)OC |
| InChI | InChI=1S/C20H31NO2/c1-5-6-7-8-12-15-19(23-20(2,3)22-4)17-21-16-18-13-10-9-11-14-18/h9-15,17,19H,5-8,16H2,1-4H3/b15-12+,21-17+/t19-/m1/s1 |
| InChIKey | LFWCROBEHDPBDD-JPUFQAOXSA-N |
| XLogP | 5.16 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|