C26H45BrO5Si — CID 134876363
(4aS,4bS,5R,8aR,10R,10aS)-10-(2-bromo-1-ethoxyethoxy)-5-[tert-butyl(dimethyl)silyl]oxy-10a-(hydroxymethyl)-4b-methyl-4a,5,6,7,8,8a,9,10-octahydro-4H-phenanthren-3-one (PubChem CID 134876363) has the molecular formula C26H45BrO5Si and a molecular weight of 545.63 g/mol. Its IUPAC name is (4aS,4bS,5R,8aR,10R,10aS)-10-(2-bromo-1-ethoxyethoxy)-5-[tert-butyl(dimethyl)silyl]oxy-10a-(hydroxymethyl)-4b-methyl-4a,5,6,7,8,8a,9,10-octahydro-4H-phenanthren-3-one.
| Compound Name | (4aS,4bS,5R,8aR,10R,10aS)-10-(2-bromo-1-ethoxyethoxy)-5-[tert-butyl(dimethyl)silyl]oxy-10a-(hydroxymethyl)-4b-methyl-4a,5,6,7,8,8a,9,10-octahydro-4H-phenanthren-3-one |
|---|---|
| PubChem CID | 134876363 |
| Molecular Formula | C26H45BrO5Si |
| Molecular Weight | 545.63 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | (4aS,4bS,5R,8aR,10R,10aS)-10-(2-bromo-1-ethoxyethoxy)-5-[tert-butyl(dimethyl)silyl]oxy-10a-(hydroxymethyl)-4b-methyl-4a,5,6,7,8,8a,9,10-octahydro-4H-phenanthren-3-one |
| SMILES | CCOC(CBr)O[C@@H]1C[C@H]2CCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@]2(C)[C@@H]2CC(=O)C=C[C@@]21CO |
| InChI | InChI=1S/C26H45BrO5Si/c1-8-30-23(16-27)31-22-14-18-10-9-11-21(32-33(6,7)24(2,3)4)25(18,5)20-15-19(29)12-13-26(20,22)17-28/h12-13,18,20-23,28H,8-11,14-17H2,1-7H3/t18-,20+,21-,22-,23?,25+,26-/m1/s1 |
| InChIKey | MLJBLMIPXGSYCO-SWDBMUOYSA-N |
| XLogP | 5.85 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.63 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|