C13H15N5O4 — CID 134877031
7,7,7a-trimethyl-3-(4-nitrophenyl)-1,6-dihydroimidazo[1,5-b][1,2,4]triazole-2,5-dione (PubChem CID 134877031) has the molecular formula C13H15N5O4 and a molecular weight of 305.29 g/mol. Its IUPAC name is 7,7,7a-trimethyl-3-(4-nitrophenyl)-1,6-dihydroimidazo[1,5-b][1,2,4]triazole-2,5-dione.
| Compound Name | 7,7,7a-trimethyl-3-(4-nitrophenyl)-1,6-dihydroimidazo[1,5-b][1,2,4]triazole-2,5-dione |
|---|---|
| PubChem CID | 134877031 |
| Molecular Formula | C13H15N5O4 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 7,7,7a-trimethyl-3-(4-nitrophenyl)-1,6-dihydroimidazo[1,5-b][1,2,4]triazole-2,5-dione |
| SMILES | CC1(C)NC(=O)N2N(c3ccc([N+](=O)[O-])cc3)C(=O)NC21C |
| InChI | InChI=1S/C13H15N5O4/c1-12(2)13(3)15-10(19)16(17(13)11(20)14-12)8-4-6-9(7-5-8)18(21)22/h4-7H,1-3H3,(H,14,20)(H,15,19) |
| InChIKey | MHLZPQJJZAQJTH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|