C32H26O8S — CID 134878376
[(2R,3R,4R,5S)-5-(benzenesulfinyl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate (PubChem CID 134878376) has the molecular formula C32H26O8S and a molecular weight of 570.62 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-5-(benzenesulfinyl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5S)-5-(benzenesulfinyl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 134878376 |
| Molecular Formula | C32H26O8S |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | [(2R,3R,4R,5S)-5-(benzenesulfinyl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](S(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H26O8S/c33-29(22-13-5-1-6-14-22)37-21-26-27(39-30(34)23-15-7-2-8-16-23)28(40-31(35)24-17-9-3-10-18-24)32(38-26)41(36)25-19-11-4-12-20-25/h1-20,26-28,32H,21H2/t26-,27-,28-,32+,41?/m1/s1 |
| InChIKey | GXZQCGYOTLRDRL-AJIJWQFGSA-N |
| XLogP | 4.83 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|