C20H20O2P+ — CID 134881053
1,1-dimethoxy-4-methylidene-2,6-diphenylphosphinin-1-ium (PubChem CID 134881053) has the molecular formula C20H20O2P+ and a molecular weight of 323.35 g/mol. Its IUPAC name is 1,1-dimethoxy-4-methylidene-2,6-diphenylphosphinin-1-ium.
| Compound Name | 1,1-dimethoxy-4-methylidene-2,6-diphenylphosphinin-1-ium |
|---|---|
| PubChem CID | 134881053 |
| Molecular Formula | C20H20O2P+ |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 1,1-dimethoxy-4-methylidene-2,6-diphenylphosphinin-1-ium |
| SMILES | C=C1C=C(c2ccccc2)[P+](OC)(OC)C(c2ccccc2)=C1 |
| InChI | InChI=1S/C20H20O2P/c1-16-14-19(17-10-6-4-7-11-17)23(21-2,22-3)20(15-16)18-12-8-5-9-13-18/h4-15H,1H2,2-3H3/q+1 |
| InChIKey | YIBVERZWTZNMRS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|