C39H35N3O4S — CID 134883213
(2R,4aR,6S,7S,8S,8aR)-6-azido-2-phenyl-8-phenylmethoxy-7-tritylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 134883213) has the molecular formula C39H35N3O4S and a molecular weight of 641.79 g/mol. Its IUPAC name is (2R,4aR,6S,7S,8S,8aR)-6-azido-2-phenyl-8-phenylmethoxy-7-tritylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6S,7S,8S,8aR)-6-azido-2-phenyl-8-phenylmethoxy-7-tritylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 134883213 |
| Molecular Formula | C39H35N3O4S |
| Molecular Weight | 641.79 g/mol |
| Exact Mass | 641.23 |
| IUPAC Name | (2R,4aR,6S,7S,8S,8aR)-6-azido-2-phenyl-8-phenylmethoxy-7-tritylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | [N-]=[N+]=N[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](OCc2ccccc2)[C@@H]1SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H35N3O4S/c40-42-41-37-36(47-39(30-20-10-3-11-21-30,31-22-12-4-13-23-31)32-24-14-5-15-25-32)35(43-26-28-16-6-1-7-17-28)34-33(45-37)27-44-38(46-34)29-18-8-2-9-19-29/h1-25,33-38H,26-27H2/t33-,34-,35+,36+,37+,38-/m1/s1 |
| InChIKey | DUFWWZILVQUYJM-JVZUUUMSSA-N |
| XLogP | 8.82 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.79 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|