C9H22N2Se2 — CID 134889980
diethylazanium;N,N-diethylcarbamodiselenoate (PubChem CID 134889980) has the molecular formula C9H22N2Se2 and a molecular weight of 316.21 g/mol. Its IUPAC name is diethylazanium;N,N-diethylcarbamodiselenoate.
| Compound Name | diethylazanium;N,N-diethylcarbamodiselenoate |
|---|---|
| PubChem CID | 134889980 |
| Molecular Formula | C9H22N2Se2 |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | diethylazanium;N,N-diethylcarbamodiselenoate |
| SMILES | CCN(CC)C(=[Se])[Se-].CC[NH2+]CC |
| InChI | InChI=1S/C5H11NSe2.C4H11N/c1-3-6(4-2)5(7)8;1-3-5-4-2/h3-4H2,1-2H3,(H,7,8);5H,3-4H2,1-2H3 |
| InChIKey | OYTLSFJIULWGPB-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 19.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|