C8H14O6 — CID 134893682
(S)-[(2R,5R)-2-hydroperoxy-5-methoxy-5-methylfuran-2-yl]-methoxymethanol (PubChem CID 134893682) has the molecular formula C8H14O6 and a molecular weight of 206.19 g/mol. Its IUPAC name is (S)-[(2R,5R)-2-hydroperoxy-5-methoxy-5-methylfuran-2-yl]-methoxymethanol.
| Compound Name | (S)-[(2R,5R)-2-hydroperoxy-5-methoxy-5-methylfuran-2-yl]-methoxymethanol |
|---|---|
| PubChem CID | 134893682 |
| Molecular Formula | C8H14O6 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | (S)-[(2R,5R)-2-hydroperoxy-5-methoxy-5-methylfuran-2-yl]-methoxymethanol |
| SMILES | CO[C@H](O)[C@]1(OO)C=C[C@](C)(OC)O1 |
| InChI | InChI=1S/C8H14O6/c1-7(12-3)4-5-8(13-7,14-10)6(9)11-2/h4-6,9-10H,1-3H3/t6-,7+,8+/m0/s1 |
| InChIKey | VFYZYQMQTUGUEU-XLPZGREQSA-N |
| XLogP | 0.09 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|