About (4-ethenyl-5-ethoxy-2,5-dihydrofuran-2-yl)methanol
(4-ethenyl-5-ethoxy-2,5-dihydrofuran-2-yl)methanol (PubChem CID 90832799) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is (4-ethenyl-5-ethoxy-2,5-dihydrofuran-2-yl)methanol.
Analyze (4-ethenyl-5-ethoxy-2,5-dihydrofuran-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethenyl-5-ethoxy-2,5-dihydrofuran-2-yl)methanol?
The IUPAC name of (4-ethenyl-5-ethoxy-2,5-dihydrofuran-2-yl)methanol (CID 90832799) is (4-ethenyl-5-ethoxy-2,5-dihydrofuran-2-yl)methanol.
What is the SMILES notation for (4-ethenyl-5-ethoxy-2,5-dihydrofuran-2-yl)methanol?
The canonical SMILES for (4-ethenyl-5-ethoxy-2,5-dihydrofuran-2-yl)methanol is C=CC1=CC(CO)OC1OCC.
What is the InChIKey of (4-ethenyl-5-ethoxy-2,5-dihydrofuran-2-yl)methanol?
The InChIKey is NAWUJEZQPSXODI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-3-7-5-8(6-10)12-9(7)11-4-2/h3,5,8-10H,1,4,6H2,2H3.
What are the key properties of (4-ethenyl-5-ethoxy-2,5-dihydrofuran-2-yl)methanol?
(4-ethenyl-5-ethoxy-2,5-dihydrofuran-2-yl)methanol has a molecular weight of 170.21 g/mol, XLogP of 0.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethenyl-5-ethoxy-2,5-dihydrofuran-2-yl)methanol is sourced from PubChem (CID 90832799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).