About carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum
carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum (PubChem CID 134897448) has the molecular formula C9H12MoNO5P
and a molecular weight of 341.11 g/mol. Its IUPAC name is carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum.
Molecular Properties
| Compound Name | carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum |
| PubChem CID | 134897448 |
| Molecular Formula | C9H12MoNO5P |
| Molecular Weight | 341.11 g/mol |
| Exact Mass | 342.95 |
| IUPAC Name | carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum |
| SMILES | CCN(P)CC.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Mo] |
| InChI | InChI=1S/C4H12NP.5CO.Mo/c1-3-5(6)4-2;5*1-2;/h3-4,6H2,1-2H3;;;;;; |
| InChIKey | ZRASFBDBSINAHO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 102.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.11 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum?
The IUPAC name of carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum (CID 134897448) is carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum.
What is the SMILES notation for carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum?
The canonical SMILES for carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum is CCN(P)CC.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Mo].
What is the InChIKey of carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum?
The InChIKey is ZRASFBDBSINAHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12NP.5CO.Mo/c1-3-5(6)4-2;5*1-2;/h3-4,6H2,1-2H3;;;;;;.
What are the key properties of carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum?
carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum has a molecular weight of 341.11 g/mol, XLogP of 0.93, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum is sourced from PubChem (CID 134897448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).