carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum

C9H12MoNO5P — CID 134897448

IUPACcarbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum
SMILESCCN(P)CC.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Mo]
InChIInChI=1S/C4H12NP.5CO.Mo/c1-3-5(6)4-2;5*1-2;/h3-4,6H2,1-2H3;;;;;;
InChIKeyZRASFBDBSINAHO-UHFFFAOYSA-N
MW341.11 g/mol
LogP0.93
Rot. Bonds2

About carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum

carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum (PubChem CID 134897448) has the molecular formula C9H12MoNO5P and a molecular weight of 341.11 g/mol. Its IUPAC name is carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum.

Molecular Properties

Compound Namecarbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum
PubChem CID134897448
Molecular FormulaC9H12MoNO5P
Molecular Weight341.11 g/mol
Exact Mass342.95
IUPAC Namecarbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum
SMILESCCN(P)CC.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Mo]
InChIInChI=1S/C4H12NP.5CO.Mo/c1-3-5(6)4-2;5*1-2;/h3-4,6H2,1-2H3;;;;;;
InChIKeyZRASFBDBSINAHO-UHFFFAOYSA-N
XLogP0.93
TPSA102.74 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500341.11
LogP ≤ 50.93
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum?
The IUPAC name of carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum (CID 134897448) is carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum.
What is the SMILES notation for carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum?
The canonical SMILES for carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum is CCN(P)CC.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Mo].
What is the InChIKey of carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum?
The InChIKey is ZRASFBDBSINAHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12NP.5CO.Mo/c1-3-5(6)4-2;5*1-2;/h3-4,6H2,1-2H3;;;;;;.
What are the key properties of carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum?
carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum has a molecular weight of 341.11 g/mol, XLogP of 0.93, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;N-ethyl-N-phosphanylethanamine;molybdenum is sourced from PubChem (CID 134897448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).