C14H18FeO5 — CID 134899583
carbon monoxide;(5R,6S)-5,6-diethoxy-1-methylcyclohexa-1,3-diene;iron (PubChem CID 134899583) has the molecular formula C14H18FeO5 and a molecular weight of 322.14 g/mol. Its IUPAC name is carbon monoxide;(5R,6S)-5,6-diethoxy-1-methylcyclohexa-1,3-diene;iron.
| Compound Name | carbon monoxide;(5R,6S)-5,6-diethoxy-1-methylcyclohexa-1,3-diene;iron |
|---|---|
| PubChem CID | 134899583 |
| Molecular Formula | C14H18FeO5 |
| Molecular Weight | 322.14 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | carbon monoxide;(5R,6S)-5,6-diethoxy-1-methylcyclohexa-1,3-diene;iron |
| SMILES | CCO[C@@H]1C=CC=C(C)[C@@H]1OCC.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C11H18O2.3CO.Fe/c1-4-12-10-8-6-7-9(3)11(10)13-5-2;3*1-2;/h6-8,10-11H,4-5H2,1-3H3;;;;/t10-,11+;;;;/m1..../s1 |
| InChIKey | OTUDLINJUNKZEL-XTJLUVPXSA-N |
| XLogP | 2.20 |
| TPSA | 78.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.14 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|