C21H32O3 — CID 134900455
(1R,2S,6S,9S)-2-[3-(1,3-dioxolan-2-yl)propyl]-2,6,9-trimethyltricyclo[7.2.1.01,6]dodec-7-en-4-one (PubChem CID 134900455) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (1R,2S,6S,9S)-2-[3-(1,3-dioxolan-2-yl)propyl]-2,6,9-trimethyltricyclo[7.2.1.01,6]dodec-7-en-4-one.
| Compound Name | (1R,2S,6S,9S)-2-[3-(1,3-dioxolan-2-yl)propyl]-2,6,9-trimethyltricyclo[7.2.1.01,6]dodec-7-en-4-one |
|---|---|
| PubChem CID | 134900455 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (1R,2S,6S,9S)-2-[3-(1,3-dioxolan-2-yl)propyl]-2,6,9-trimethyltricyclo[7.2.1.01,6]dodec-7-en-4-one |
| SMILES | C[C@]12C=C[C@]3(C)CC(=O)C[C@](C)(CCCC4OCCO4)[C@@]3(CC1)C2 |
| InChI | InChI=1S/C21H32O3/c1-18-7-9-20(3)14-16(22)13-19(2,21(20,15-18)10-8-18)6-4-5-17-23-11-12-24-17/h7,9,17H,4-6,8,10-15H2,1-3H3/t18-,19-,20+,21+/m0/s1 |
| InChIKey | QSWUNSCTSUCDGT-UWHLTILDSA-N |
| XLogP | 4.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|