C11H13BO2 — CID 134903924
2-pent-1-en-2-yl-1,3,2-benzodioxaborole (PubChem CID 134903924) has the molecular formula C11H13BO2 and a molecular weight of 188.03 g/mol. Its IUPAC name is 2-pent-1-en-2-yl-1,3,2-benzodioxaborole.
| Compound Name | 2-pent-1-en-2-yl-1,3,2-benzodioxaborole |
|---|---|
| PubChem CID | 134903924 |
| Molecular Formula | C11H13BO2 |
| Molecular Weight | 188.03 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 2-pent-1-en-2-yl-1,3,2-benzodioxaborole |
| SMILES | C=C(CCC)B1Oc2ccccc2O1 |
| InChI | InChI=1S/C11H13BO2/c1-3-6-9(2)12-13-10-7-4-5-8-11(10)14-12/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | KWQFLQJHMZCCSZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.03 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|