About beryllium;2-(dimethylamino)ethyl-methylazanide;hydride
beryllium;2-(dimethylamino)ethyl-methylazanide;hydride (PubChem CID 134906139) has the molecular formula C5H14BeN2
and a molecular weight of 111.19 g/mol. Its IUPAC name is beryllium;2-(dimethylamino)ethyl-methylazanide;hydride.
Molecular Properties
| Compound Name | beryllium;2-(dimethylamino)ethyl-methylazanide;hydride |
| PubChem CID | 134906139 |
| Molecular Formula | C5H14BeN2 |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.13 |
| IUPAC Name | beryllium;2-(dimethylamino)ethyl-methylazanide;hydride |
| SMILES | C[N-]CCN(C)C.[Be+2].[H-] |
| InChI | InChI=1S/C5H13N2.Be.H/c1-6-4-5-7(2)3;;/h4-5H2,1-3H3;;/q-1;+2;-1 |
| InChIKey | DVHGSTFAVOFDKQ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze beryllium;2-(dimethylamino)ethyl-methylazanide;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of beryllium;2-(dimethylamino)ethyl-methylazanide;hydride?
The IUPAC name of beryllium;2-(dimethylamino)ethyl-methylazanide;hydride (CID 134906139) is beryllium;2-(dimethylamino)ethyl-methylazanide;hydride.
What is the SMILES notation for beryllium;2-(dimethylamino)ethyl-methylazanide;hydride?
The canonical SMILES for beryllium;2-(dimethylamino)ethyl-methylazanide;hydride is C[N-]CCN(C)C.[Be+2].[H-].
What is the InChIKey of beryllium;2-(dimethylamino)ethyl-methylazanide;hydride?
The InChIKey is DVHGSTFAVOFDKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N2.Be.H/c1-6-4-5-7(2)3;;/h4-5H2,1-3H3;;/q-1;+2;-1.
What are the key properties of beryllium;2-(dimethylamino)ethyl-methylazanide;hydride?
beryllium;2-(dimethylamino)ethyl-methylazanide;hydride has a molecular weight of 111.19 g/mol, XLogP of 0.28, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for beryllium;2-(dimethylamino)ethyl-methylazanide;hydride is sourced from PubChem (CID 134906139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).