C21H9ClF6O5 — CID 134910729
2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-6-(4-hydroxy-2-oxochromen-6-yl)chromen-4-one (PubChem CID 134910729) has the molecular formula C21H9ClF6O5 and a molecular weight of 490.74 g/mol. Its IUPAC name is 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-6-(4-hydroxy-2-oxochromen-6-yl)chromen-4-one.
| Compound Name | 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-6-(4-hydroxy-2-oxochromen-6-yl)chromen-4-one |
|---|---|
| PubChem CID | 134910729 |
| Molecular Formula | C21H9ClF6O5 |
| Molecular Weight | 490.74 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-6-(4-hydroxy-2-oxochromen-6-yl)chromen-4-one |
| SMILES | O=c1cc(O)c2cc(-c3ccc4oc(C(F)(F)C(F)(F)C(F)(F)Cl)cc(=O)c4c3)ccc2o1 |
| InChI | InChI=1S/C21H9ClF6O5/c22-21(27,28)20(25,26)19(23,24)17-7-13(29)11-5-9(1-3-15(11)32-17)10-2-4-16-12(6-10)14(30)8-18(31)33-16/h1-8,30H |
| InChIKey | GRWKCUQNBDBHAE-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.74 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|