C18H4Cl2F12O4 — CID 134910760
3,8-bis(3-chloro-1,1,2,2,3,3-hexafluoropropyl)pyrano[2,3-f]chromene-4,10-dione (PubChem CID 134910760) has the molecular formula C18H4Cl2F12O4 and a molecular weight of 583.11 g/mol. Its IUPAC name is 3,8-bis(3-chloro-1,1,2,2,3,3-hexafluoropropyl)pyrano[2,3-f]chromene-4,10-dione.
| Compound Name | 3,8-bis(3-chloro-1,1,2,2,3,3-hexafluoropropyl)pyrano[2,3-f]chromene-4,10-dione |
|---|---|
| PubChem CID | 134910760 |
| Molecular Formula | C18H4Cl2F12O4 |
| Molecular Weight | 583.11 g/mol |
| Exact Mass | 581.93 |
| IUPAC Name | 3,8-bis(3-chloro-1,1,2,2,3,3-hexafluoropropyl)pyrano[2,3-f]chromene-4,10-dione |
| SMILES | O=c1c(C(F)(F)C(F)(F)C(F)(F)Cl)coc2c1ccc1oc(C(F)(F)C(F)(F)C(F)(F)Cl)cc(=O)c12 |
| InChI | InChI=1S/C18H4Cl2F12O4/c19-17(29,30)15(25,26)13(21,22)6-4-35-12-5(11(6)34)1-2-8-10(12)7(33)3-9(36-8)14(23,24)16(27,28)18(20,31)32/h1-4H |
| InChIKey | GXEKRVUMEKEEGB-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.11 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|