C22H31NO2Si — CID 134925737
[(3R,5R)-2-benzyl-3-phenyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134925737) has the molecular formula C22H31NO2Si and a molecular weight of 369.58 g/mol. Its IUPAC name is [(3R,5R)-2-benzyl-3-phenyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,5R)-2-benzyl-3-phenyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134925737 |
| Molecular Formula | C22H31NO2Si |
| Molecular Weight | 369.58 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | [(3R,5R)-2-benzyl-3-phenyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H](c2ccccc2)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C22H31NO2Si/c1-22(2,3)26(4,5)25-21-16-20(19-14-10-7-11-15-19)23(24-21)17-18-12-8-6-9-13-18/h6-15,20-21H,16-17H2,1-5H3/t20-,21-/m1/s1 |
| InChIKey | SCSKTULETCIGSV-NHCUHLMSSA-N |
| XLogP | 5.91 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|