C19H26N3O9S3+ — CID 134925832
(3,5-dinitro-4-sulfophenyl)-[(2-methyl-1,3,4,5,6,8,9,10,11,12-decahydro-2λ4,7-benzodithiecin-2-yl)oxy]-oxoazanium (PubChem CID 134925832) has the molecular formula C19H26N3O9S3+ and a molecular weight of 536.63 g/mol. Its IUPAC name is (3,5-dinitro-4-sulfophenyl)-[(2-methyl-1,3,4,5,6,8,9,10,11,12-decahydro-2λ4,7-benzodithiecin-2-yl)oxy]-oxoazanium.
| Compound Name | (3,5-dinitro-4-sulfophenyl)-[(2-methyl-1,3,4,5,6,8,9,10,11,12-decahydro-2λ4,7-benzodithiecin-2-yl)oxy]-oxoazanium |
|---|---|
| PubChem CID | 134925832 |
| Molecular Formula | C19H26N3O9S3+ |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | (3,5-dinitro-4-sulfophenyl)-[(2-methyl-1,3,4,5,6,8,9,10,11,12-decahydro-2λ4,7-benzodithiecin-2-yl)oxy]-oxoazanium |
| SMILES | CS1(O[N+](=O)c2cc([N+](=O)[O-])c(S(=O)(=O)O)c([N+](=O)[O-])c2)CCCCSCC2=C(CCCC2)C1 |
| InChI | InChI=1S/C19H25N3O9S3/c1-33(9-5-4-8-32-12-14-6-2-3-7-15(14)13-33)31-22(27)16-10-17(20(23)24)19(34(28,29)30)18(11-16)21(25)26/h10-11H,2-9,12-13H2,1H3/p+1 |
| InChIKey | NHCJEHWQQDPVSX-UHFFFAOYSA-O |
| XLogP | 4.84 |
| TPSA | 169.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|