C15H22N3O9S3+ — CID 134926646
(3,5-dinitro-2-sulfophenyl)-oxo-[(1,2,3-trimethyl-1,4-dithiocan-1-yl)oxy]azanium (PubChem CID 134926646) has the molecular formula C15H22N3O9S3+ and a molecular weight of 484.55 g/mol. Its IUPAC name is (3,5-dinitro-2-sulfophenyl)-oxo-[(1,2,3-trimethyl-1,4-dithiocan-1-yl)oxy]azanium.
| Compound Name | (3,5-dinitro-2-sulfophenyl)-oxo-[(1,2,3-trimethyl-1,4-dithiocan-1-yl)oxy]azanium |
|---|---|
| PubChem CID | 134926646 |
| Molecular Formula | C15H22N3O9S3+ |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | (3,5-dinitro-2-sulfophenyl)-oxo-[(1,2,3-trimethyl-1,4-dithiocan-1-yl)oxy]azanium |
| SMILES | CC1SCCCCS(C)(O[N+](=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2S(=O)(=O)O)C1C |
| InChI | InChI=1S/C15H21N3O9S3/c1-10-11(2)29(3,7-5-4-6-28-10)27-18(23)14-9-12(16(19)20)8-13(17(21)22)15(14)30(24,25)26/h8-11H,4-7H2,1-3H3/p+1 |
| InChIKey | RAKNLMBKEMROJW-UHFFFAOYSA-O |
| XLogP | 3.75 |
| TPSA | 169.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|