C13H14BrN3O7S — CID 134926644
4-[(7-bromo-2,3,5,6,7,7a-hexahydro-1H-thieno[1,2-a]thiophen-4-yl)oxy-oxoazaniumyl]-2,6-dinitrophenolate (PubChem CID 134926644) has the molecular formula C13H14BrN3O7S and a molecular weight of 436.24 g/mol. Its IUPAC name is 4-[(7-bromo-2,3,5,6,7,7a-hexahydro-1H-thieno[1,2-a]thiophen-4-yl)oxy-oxoazaniumyl]-2,6-dinitrophenolate.
| Compound Name | 4-[(7-bromo-2,3,5,6,7,7a-hexahydro-1H-thieno[1,2-a]thiophen-4-yl)oxy-oxoazaniumyl]-2,6-dinitrophenolate |
|---|---|
| PubChem CID | 134926644 |
| Molecular Formula | C13H14BrN3O7S |
| Molecular Weight | 436.24 g/mol |
| Exact Mass | 434.97 |
| IUPAC Name | 4-[(7-bromo-2,3,5,6,7,7a-hexahydro-1H-thieno[1,2-a]thiophen-4-yl)oxy-oxoazaniumyl]-2,6-dinitrophenolate |
| SMILES | O=[N+]([O-])c1cc([N+](=O)OS23CCCC2C(Br)CC3)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C13H14BrN3O7S/c14-9-3-5-25(4-1-2-12(9)25)24-17(23)8-6-10(15(19)20)13(18)11(7-8)16(21)22/h6-7,9,12H,1-5H2 |
| InChIKey | MWFSTEXKJWEZIK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 138.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|