C15H20OS — CID 134927612
(2S,3S)-3-methyl-2-(1-phenylsulfanylcyclopentyl)oxetane (PubChem CID 134927612) has the molecular formula C15H20OS and a molecular weight of 248.39 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-(1-phenylsulfanylcyclopentyl)oxetane.
| Compound Name | (2S,3S)-3-methyl-2-(1-phenylsulfanylcyclopentyl)oxetane |
|---|---|
| PubChem CID | 134927612 |
| Molecular Formula | C15H20OS |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (2S,3S)-3-methyl-2-(1-phenylsulfanylcyclopentyl)oxetane |
| SMILES | C[C@H]1CO[C@@H]1C1(Sc2ccccc2)CCCC1 |
| InChI | InChI=1S/C15H20OS/c1-12-11-16-14(12)15(9-5-6-10-15)17-13-7-3-2-4-8-13/h2-4,7-8,12,14H,5-6,9-11H2,1H3/t12-,14-/m0/s1 |
| InChIKey | WUNRLCHLXBZIRR-JSGCOSHPSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |