C21H30OS — CID 14969023
(3R,5Z)-6,10-dimethyl-10-phenylsulfanyl-3-prop-1-en-2-ylcyclodec-5-en-1-ol (PubChem CID 14969023) has the molecular formula C21H30OS and a molecular weight of 330.54 g/mol. Its IUPAC name is (3R,5Z)-6,10-dimethyl-10-phenylsulfanyl-3-prop-1-en-2-ylcyclodec-5-en-1-ol.
| Compound Name | (3R,5Z)-6,10-dimethyl-10-phenylsulfanyl-3-prop-1-en-2-ylcyclodec-5-en-1-ol |
|---|---|
| PubChem CID | 14969023 |
| Molecular Formula | C21H30OS |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (3R,5Z)-6,10-dimethyl-10-phenylsulfanyl-3-prop-1-en-2-ylcyclodec-5-en-1-ol |
| SMILES | C=C(C)[C@@H]1C/C=C(/C)CCCC(C)(Sc2ccccc2)C(O)C1 |
| InChI | InChI=1S/C21H30OS/c1-16(2)18-13-12-17(3)9-8-14-21(4,20(22)15-18)23-19-10-6-5-7-11-19/h5-7,10-12,18,20,22H,1,8-9,13-15H2,2-4H3/b17-12-/t18-,20?,21?/m1/s1 |
| InChIKey | CFFXPIISSDQSHM-SFCFLULUSA-N |
| XLogP | 6.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|